Koenzim B

S Wikipedije, slobodne enciklopedije
Jump to navigation Jump to search
Koenzim B
Coenzyme B (CoB).svg
Općenito
Hemijski spoj Koenzim B
Druga imena IUPAC-ime: 2-[(7-merkapto-1-oksoheptil)amino]-3-fosfonooksibutanska kiselina
Molekularna formula C11H22NO7PS
CAS registarski broj 104302-77-4
SMILES O=C(N[C@@H](C(=O)O)[C@H](OP(=O)(O)O)C)CCCCCCS
InChI 1/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)/t8-,10-/m1/s1
Osobine1
Rizičnost
NFPA 704
NFPA 704.svg
0
0
0
 
1 Gdje god je moguće korištene su SI jedinice. Ako nije drugačije naznačeno, dati podaci vrijede pri standardnim uslovima.

Koenzim B − 7-merkaptoheptanoiltreoninfosfat − je neophodan u redoks reakijama metabolizma metanotrofa.[1] Njegova molekula sadrži tiol, koji je glavno mjesto reakcije.

Ovaj koenzim reagira sa 2-metiltioetansulfonatom (metil-koenzimom M, skraćeno CH3–S–CoM), pri čemu se u procesu metanogenezeformira metan:[2]

CH3–S–CoM + HS–CoB → CH4 + CoB–S–S–CoM

Ovu konverziju katalizira enzim metil koenzim M reduktaza, koja sadrži kofaktor F430 kao prostetsku grupu.

Srodna pretvorba koja koristi HS-CoB i HS-CoM počiva na redukciji fumarata do sukcinata, koja je katalizirana fumarat reduktazom:[3]

CH3–S–CoM + HS–CoB O2CCH=CHCO
2
O2CCH2–CH2CO
2
+ CoB–S–S–CoM

Također pogledajte[uredi | uredi izvor]

Reference[uredi | uredi izvor]

  1. ^ Noll KM, Rinehart KL, Tanner RS, Wolfe RS (1986). "Structure of component B (7-mercaptoheptanoylthreonine phosphate) of the methylcoenzyme M methylreductase system of Methanobacterium thermoautotrophicum". Proc. Natl. Acad. Sci. U.S.A. 83 (12): 4238–42. PMC 323707. PMID 3086878. doi:10.1073/pnas.83.12.4238. 
  2. ^ Thauer RK (September 1998). "Biochemistry of methanogenesis: a tribute to Marjory Stephenson. 1998 Marjory Stephenson Prize Lecture". Microbiology 144 (Pt 9): 2377–406. PMID 9782487. doi:10.1099/00221287-144-9-2377. 
  3. ^ Heim S, Künkel A, Thauer RK, Hedderich R (April 1998). "Thiol:fumarate reductase (Tfr) from Methanobacterium thermoautotrophicum—identification of the catalytic sites for fumarate reduction and thiol oxidation". Eur. J. Biochem. 253 (1): 292–9. PMID 9578488. doi:10.1046/j.1432-1327.1998.2530292.x. 

Vanjski linkovi[uredi | uredi izvor]